About 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole
5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole (PubChem CID 123389407) has the molecular formula C7H13FN2
and a molecular weight of 144.19 g/mol. Its IUPAC name is 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole |
| PubChem CID | 123389407 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole |
| SMILES | CC1=CN(C)NC1C(C)F |
| InChI | InChI=1S/C7H13FN2/c1-5-4-10(3)9-7(5)6(2)8/h4,6-7,9H,1-3H3 |
| InChIKey | ODMWJLMBNXCNRD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole?
The IUPAC name of 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole (CID 123389407) is 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole.
What is the SMILES notation for 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole?
The canonical SMILES for 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole is CC1=CN(C)NC1C(C)F.
What is the InChIKey of 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole?
The InChIKey is ODMWJLMBNXCNRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FN2/c1-5-4-10(3)9-7(5)6(2)8/h4,6-7,9H,1-3H3.
What are the key properties of 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole?
5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole has a molecular weight of 144.19 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-fluoroethyl)-2,4-dimethyl-1,5-dihydropyrazole is sourced from PubChem (CID 123389407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).