C12H14FN — CID 123389573
8-fluoro-4-propyl-6,7-dihydroquinoline (PubChem CID 123389573) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 8-fluoro-4-propyl-6,7-dihydroquinoline.
| Compound Name | 8-fluoro-4-propyl-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 123389573 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 8-fluoro-4-propyl-6,7-dihydroquinoline |
| SMILES | CCCc1ccnc2c1=CCCC=2F |
| InChI | InChI=1S/C12H14FN/c1-2-4-9-7-8-14-12-10(9)5-3-6-11(12)13/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | OCVFULDYCJFSEF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |