C10H20N2 — CID 123389972
N-methyl-1-(4-methyl-2,3,4,7-tetrahydro-1H-azepin-5-yl)ethanamine (PubChem CID 123389972) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-2,3,4,7-tetrahydro-1H-azepin-5-yl)ethanamine.
| Compound Name | N-methyl-1-(4-methyl-2,3,4,7-tetrahydro-1H-azepin-5-yl)ethanamine |
|---|---|
| PubChem CID | 123389972 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N-methyl-1-(4-methyl-2,3,4,7-tetrahydro-1H-azepin-5-yl)ethanamine |
| SMILES | CNC(C)C1=CCNCCC1C |
| InChI | InChI=1S/C10H20N2/c1-8-4-6-12-7-5-10(8)9(2)11-3/h5,8-9,11-12H,4,6-7H2,1-3H3 |
| InChIKey | JPYSACXZIMXGDN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|