C24H32FN5O5S — CID 123390234
4-[1-[[1-[(4-fluoro-3-methoxyphenyl)methyl]piperidin-4-yl]-methylcarbamoyl]imidazol-4-yl]hexa-2,4-dien-2-yl sulfamate (PubChem CID 123390234) has the molecular formula C24H32FN5O5S and a molecular weight of 521.62 g/mol. Its IUPAC name is 4-[1-[[1-[(4-fluoro-3-methoxyphenyl)methyl]piperidin-4-yl]-methylcarbamoyl]imidazol-4-yl]hexa-2,4-dien-2-yl sulfamate.
| Compound Name | 4-[1-[[1-[(4-fluoro-3-methoxyphenyl)methyl]piperidin-4-yl]-methylcarbamoyl]imidazol-4-yl]hexa-2,4-dien-2-yl sulfamate |
|---|---|
| PubChem CID | 123390234 |
| Molecular Formula | C24H32FN5O5S |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 4-[1-[[1-[(4-fluoro-3-methoxyphenyl)methyl]piperidin-4-yl]-methylcarbamoyl]imidazol-4-yl]hexa-2,4-dien-2-yl sulfamate |
| SMILES | CC=C(C=C(C)OS(N)(=O)=O)c1cn(C(=O)N(C)C2CCN(Cc3ccc(F)c(OC)c3)CC2)cn1 |
| InChI | InChI=1S/C24H32FN5O5S/c1-5-19(12-17(2)35-36(26,32)33)22-15-30(16-27-22)24(31)28(3)20-8-10-29(11-9-20)14-18-6-7-21(25)23(13-18)34-4/h5-7,12-13,15-16,20H,8-11,14H2,1-4H3,(H2,26,32,33) |
| InChIKey | JNLJBAZFXNSULB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|