About 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene
5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene (PubChem CID 123390260) has the molecular formula C19H28
and a molecular weight of 256.43 g/mol. Its IUPAC name is 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene |
| PubChem CID | 123390260 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene |
| SMILES | C=C(C)C(=CC)C(=CC)C(C)C1C=CC(C)=CC1C |
| InChI | InChI=1S/C19H28/c1-8-17(13(3)4)18(9-2)16(7)19-11-10-14(5)12-15(19)6/h8-12,15-16,19H,3H2,1-2,4-7H3 |
| InChIKey | DHVJLZSIIIASHO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene?
The IUPAC name of 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene (CID 123390260) is 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene is C=C(C)C(=CC)C(=CC)C(C)C1C=CC(C)=CC1C.
What is the InChIKey of 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene?
The InChIKey is DHVJLZSIIIASHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28/c1-8-17(13(3)4)18(9-2)16(7)19-11-10-14(5)12-15(19)6/h8-12,15-16,19H,3H2,1-2,4-7H3.
What are the key properties of 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene?
5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene has a molecular weight of 256.43 g/mol, XLogP of 5.86, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-ethylidene-4-prop-1-en-2-ylhex-4-en-2-yl)-2,6-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 123390260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).