About 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol
2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol (PubChem CID 123390332) has the molecular formula C6H5N3OS
and a molecular weight of 167.19 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol |
| PubChem CID | 123390332 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol |
| SMILES | Oc1csc(-c2ccn[nH]2)n1 |
| InChI | InChI=1S/C6H5N3OS/c10-5-3-11-6(8-5)4-1-2-7-9-4/h1-3,10H,(H,7,9) |
| InChIKey | MFKMPGXAAKGVLE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol?
The IUPAC name of 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol (CID 123390332) is 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol.
What is the SMILES notation for 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol?
The canonical SMILES for 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol is Oc1csc(-c2ccn[nH]2)n1.
What is the InChIKey of 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol?
The InChIKey is MFKMPGXAAKGVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3OS/c10-5-3-11-6(8-5)4-1-2-7-9-4/h1-3,10H,(H,7,9).
What are the key properties of 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol?
2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol has a molecular weight of 167.19 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrazol-5-yl)-1,3-thiazol-4-ol is sourced from PubChem (CID 123390332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).