About propan-2-yl 1H-indole-2-carboxylate
propan-2-yl 1H-indole-2-carboxylate (PubChem CID 1233904) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is propan-2-yl 1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 1H-indole-2-carboxylate |
| PubChem CID | 1233904 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | propan-2-yl 1H-indole-2-carboxylate |
| SMILES | CC(C)OC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H13NO2/c1-8(2)15-12(14)11-7-9-5-3-4-6-10(9)13-11/h3-8,13H,1-2H3 |
| InChIKey | DEQPQVNEKHSACA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl 1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 1H-indole-2-carboxylate?
The IUPAC name of propan-2-yl 1H-indole-2-carboxylate (CID 1233904) is propan-2-yl 1H-indole-2-carboxylate.
What is the SMILES notation for propan-2-yl 1H-indole-2-carboxylate?
The canonical SMILES for propan-2-yl 1H-indole-2-carboxylate is CC(C)OC(=O)c1cc2ccccc2[nH]1.
What is the InChIKey of propan-2-yl 1H-indole-2-carboxylate?
The InChIKey is DEQPQVNEKHSACA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-8(2)15-12(14)11-7-9-5-3-4-6-10(9)13-11/h3-8,13H,1-2H3.
What are the key properties of propan-2-yl 1H-indole-2-carboxylate?
propan-2-yl 1H-indole-2-carboxylate has a molecular weight of 203.24 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 1H-indole-2-carboxylate is sourced from PubChem (CID 1233904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).