C19H29F3O3 — CID 123390442
3-methoxy-5,7-dimethyl-8-[3-(trifluoromethyl)hepta-2,6-dienoxy]octa-1,6-dien-4-ol (PubChem CID 123390442) has the molecular formula C19H29F3O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-methoxy-5,7-dimethyl-8-[3-(trifluoromethyl)hepta-2,6-dienoxy]octa-1,6-dien-4-ol.
| Compound Name | 3-methoxy-5,7-dimethyl-8-[3-(trifluoromethyl)hepta-2,6-dienoxy]octa-1,6-dien-4-ol |
|---|---|
| PubChem CID | 123390442 |
| Molecular Formula | C19H29F3O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 3-methoxy-5,7-dimethyl-8-[3-(trifluoromethyl)hepta-2,6-dienoxy]octa-1,6-dien-4-ol |
| SMILES | C=CCCC(=CCOCC(C)=CC(C)C(O)C(C=C)OC)C(F)(F)F |
| InChI | InChI=1S/C19H29F3O3/c1-6-8-9-16(19(20,21)22)10-11-25-13-14(3)12-15(4)18(23)17(7-2)24-5/h6-7,10,12,15,17-18,23H,1-2,8-9,11,13H2,3-5H3 |
| InChIKey | IFQDUUHEDMDHAO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|