C15H26N4O5S — CID 123390797
(dibutylamino) [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 123390797) has the molecular formula C15H26N4O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is (dibutylamino) [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | (dibutylamino) [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 123390797 |
| Molecular Formula | C15H26N4O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (dibutylamino) [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [C-]#[N+][C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)ON(CCCC)CCCC |
| InChI | InChI=1S/C15H26N4O5S/c1-4-6-10-17(11-7-5-2)23-25(21,22)24-19-13-8-9-14(16-3)18(12-13)15(19)20/h13-14H,4-12H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | WRRAIROOAFRYAI-KGLIPLIRSA-N |
| XLogP | 2.14 |
| TPSA | 83.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|