C18H22N2O2 — CID 123391037
5-(2,5-dimethylphenyl)-1-methyl-3-morpholin-4-ylpyridin-2-one (PubChem CID 123391037) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-(2,5-dimethylphenyl)-1-methyl-3-morpholin-4-ylpyridin-2-one.
| Compound Name | 5-(2,5-dimethylphenyl)-1-methyl-3-morpholin-4-ylpyridin-2-one |
|---|---|
| PubChem CID | 123391037 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 5-(2,5-dimethylphenyl)-1-methyl-3-morpholin-4-ylpyridin-2-one |
| SMILES | Cc1ccc(C)c(-c2cc(N3CCOCC3)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C18H22N2O2/c1-13-4-5-14(2)16(10-13)15-11-17(18(21)19(3)12-15)20-6-8-22-9-7-20/h4-5,10-12H,6-9H2,1-3H3 |
| InChIKey | WUKLBVUIAWZMFS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |