About ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate
ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate (PubChem CID 123391459) has the molecular formula C10H11ClN4OS
and a molecular weight of 270.74 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate.
Molecular Properties
| Compound Name | ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate |
| PubChem CID | 123391459 |
| Molecular Formula | C10H11ClN4OS |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate |
| SMILES | [H]/N=C(/CNc1c(Cl)ccc2nsnc12)OCC |
| InChI | InChI=1S/C10H11ClN4OS/c1-2-16-8(12)5-13-9-6(11)3-4-7-10(9)15-17-14-7/h3-4,12-13H,2,5H2,1H3/b12-8- |
| InChIKey | ZEYOCWRSXUOHDR-WQLSENKSSA-N |
| XLogP | 2.77 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate?
The IUPAC name of ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate (CID 123391459) is ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate.
What is the SMILES notation for ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate?
The canonical SMILES for ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate is [H]/N=C(/CNc1c(Cl)ccc2nsnc12)OCC.
What is the InChIKey of ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate?
The InChIKey is ZEYOCWRSXUOHDR-WQLSENKSSA-N. The full InChI is InChI=1S/C10H11ClN4OS/c1-2-16-8(12)5-13-9-6(11)3-4-7-10(9)15-17-14-7/h3-4,12-13H,2,5H2,1H3/b12-8-.
What are the key properties of ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate?
ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate has a molecular weight of 270.74 g/mol, XLogP of 2.77, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]ethanimidate is sourced from PubChem (CID 123391459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).