C25H22ClFN3O3+ — CID 123391483
1-(2-chlorophenyl)ethyl N-[5-[4-(6-fluoro-1-methylpyridin-1-ium-3-yl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 123391483) has the molecular formula C25H22ClFN3O3+ and a molecular weight of 466.92 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl N-[5-[4-(6-fluoro-1-methylpyridin-1-ium-3-yl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | 1-(2-chlorophenyl)ethyl N-[5-[4-(6-fluoro-1-methylpyridin-1-ium-3-yl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 123391483 |
| Molecular Formula | C25H22ClFN3O3+ |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl N-[5-[4-(6-fluoro-1-methylpyridin-1-ium-3-yl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2ccc(-c3ccc(F)[n+](C)c3)cc2)c1NC(=O)OC(C)c1ccccc1Cl |
| InChI | InChI=1S/C25H21ClFN3O3/c1-15-23(28-25(31)32-16(2)20-6-4-5-7-21(20)26)24(33-29-15)18-10-8-17(9-11-18)19-12-13-22(27)30(3)14-19/h4-14,16H,1-3H3/p+1 |
| InChIKey | VZHWJJCGVDIZSS-UHFFFAOYSA-O |
| XLogP | 6.24 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|