C21H24N4O3S2 — CID 123391521
N-[5-(4-aminopiperidin-1-yl)sulfonyl-2-ethynylhexa-2,4-dienyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 123391521) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[5-(4-aminopiperidin-1-yl)sulfonyl-2-ethynylhexa-2,4-dienyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[5-(4-aminopiperidin-1-yl)sulfonyl-2-ethynylhexa-2,4-dienyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123391521 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[5-(4-aminopiperidin-1-yl)sulfonyl-2-ethynylhexa-2,4-dienyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | C#CC(=CC=C(C)S(=O)(=O)N1CCC(N)CC1)CNC(=O)c1cc2ccncc2s1 |
| InChI | InChI=1S/C21H24N4O3S2/c1-3-16(5-4-15(2)30(27,28)25-10-7-18(22)8-11-25)13-24-21(26)19-12-17-6-9-23-14-20(17)29-19/h1,4-6,9,12,14,18H,7-8,10-11,13,22H2,2H3,(H,24,26) |
| InChIKey | BNYYIPNGGYWKIB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|