C17H27NO — CID 123391664
1-(2-isocyanatopropan-2-yl)-3-(2,3,3-trimethylbutan-2-yl)cyclohexa-1,3-diene (PubChem CID 123391664) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-(2-isocyanatopropan-2-yl)-3-(2,3,3-trimethylbutan-2-yl)cyclohexa-1,3-diene.
| Compound Name | 1-(2-isocyanatopropan-2-yl)-3-(2,3,3-trimethylbutan-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123391664 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1-(2-isocyanatopropan-2-yl)-3-(2,3,3-trimethylbutan-2-yl)cyclohexa-1,3-diene |
| SMILES | CC(C)(N=C=O)C1=CC(C(C)(C)C(C)(C)C)=CCC1 |
| InChI | InChI=1S/C17H27NO/c1-15(2,3)16(4,5)13-9-8-10-14(11-13)17(6,7)18-12-19/h9,11H,8,10H2,1-7H3 |
| InChIKey | YKHZSCUFTCYUNR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|