C11H16O2 — CID 123391718
4-methyl-9-oxatricyclo[5.3.1.04,11]undecan-8-one (PubChem CID 123391718) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-methyl-9-oxatricyclo[5.3.1.04,11]undecan-8-one.
| Compound Name | 4-methyl-9-oxatricyclo[5.3.1.04,11]undecan-8-one |
|---|---|
| PubChem CID | 123391718 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-methyl-9-oxatricyclo[5.3.1.04,11]undecan-8-one |
| SMILES | CC12CCC3COC(=O)C(CC1)C32 |
| InChI | InChI=1S/C11H16O2/c1-11-4-2-7-6-13-10(12)8(3-5-11)9(7)11/h7-9H,2-6H2,1H3 |
| InChIKey | KRNLTJZCZYWBRW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |