About 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one
4,5-bis(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 123392027) has the molecular formula C6H6F6N2O
and a molecular weight of 236.12 g/mol. Its IUPAC name is 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one |
| PubChem CID | 123392027 |
| Molecular Formula | C6H6F6N2O |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCC(C(F)(F)F)C(C(F)(F)F)N1 |
| InChI | InChI=1S/C6H6F6N2O/c7-5(8,9)2-1-13-4(15)14-3(2)6(10,11)12/h2-3H,1H2,(H2,13,14,15) |
| InChIKey | OEHRFTVTUXEZHG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one?
The IUPAC name of 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one (CID 123392027) is 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one.
What is the SMILES notation for 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one?
The canonical SMILES for 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one is O=C1NCC(C(F)(F)F)C(C(F)(F)F)N1.
What is the InChIKey of 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one?
The InChIKey is OEHRFTVTUXEZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F6N2O/c7-5(8,9)2-1-13-4(15)14-3(2)6(10,11)12/h2-3H,1H2,(H2,13,14,15).
What are the key properties of 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one?
4,5-bis(trifluoromethyl)-1,3-diazinan-2-one has a molecular weight of 236.12 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(trifluoromethyl)-1,3-diazinan-2-one is sourced from PubChem (CID 123392027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).