C29H29FN8O3S — CID 123392300
2-[(3R,4S)-3-(4-fluorophenoxy)-4-hydroxypyrrolidin-1-yl]-N-[4-[6-methyl-4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]sulfanylphenyl]acetamide (PubChem CID 123392300) has the molecular formula C29H29FN8O3S and a molecular weight of 588.67 g/mol. Its IUPAC name is 2-[(3R,4S)-3-(4-fluorophenoxy)-4-hydroxypyrrolidin-1-yl]-N-[4-[6-methyl-4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]sulfanylphenyl]acetamide.
| Compound Name | 2-[(3R,4S)-3-(4-fluorophenoxy)-4-hydroxypyrrolidin-1-yl]-N-[4-[6-methyl-4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 123392300 |
| Molecular Formula | C29H29FN8O3S |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 2-[(3R,4S)-3-(4-fluorophenoxy)-4-hydroxypyrrolidin-1-yl]-N-[4-[6-methyl-4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]sulfanylphenyl]acetamide |
| SMILES | Cc1cc2c(Nc3cc(C)[nH]n3)nc(Sc3ccc(NC(=O)CN4C[C@H](O)[C@H](Oc5ccc(F)cc5)C4)cc3)nn2c1 |
| InChI | InChI=1S/C29H29FN8O3S/c1-17-11-23-28(32-26-12-18(2)34-35-26)33-29(36-38(23)13-17)42-22-9-5-20(6-10-22)31-27(40)16-37-14-24(39)25(15-37)41-21-7-3-19(30)4-8-21/h3-13,24-25,39H,14-16H2,1-2H3,(H,31,40)(H2,32,33,34,35,36)/t24-,25+/m0/s1 |
| InChIKey | NHXUFNIQEVNMKU-LOSJGSFVSA-N |
| XLogP | 4.17 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |