C15H27N3O3 — CID 123392410
methyl N-[1-(2-butanimidoylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 123392410) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is methyl N-[1-(2-butanimidoylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[1-(2-butanimidoylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123392410 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | methyl N-[1-(2-butanimidoylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | [H]/N=C(\CCC)C1CCCN1C(=O)C(NC(=O)OC)C(C)C |
| InChI | InChI=1S/C15H27N3O3/c1-5-7-11(16)12-8-6-9-18(12)14(19)13(10(2)3)17-15(20)21-4/h10,12-13,16H,5-9H2,1-4H3,(H,17,20)/b16-11+ |
| InChIKey | UWAKYHLGYHULDY-LFIBNONCSA-N |
| XLogP | 2.18 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|