About 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine
4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine (PubChem CID 123392787) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine.
Molecular Properties
| Compound Name | 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine |
| PubChem CID | 123392787 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine |
| SMILES | NC1=NC=CC2=CC2C1 |
| InChI | InChI=1S/C7H8N2/c8-7-4-6-3-5(6)1-2-9-7/h1-3,6H,4H2,(H2,8,9) |
| InChIKey | QSRUUJLEGBCTAI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine?
The IUPAC name of 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine (CID 123392787) is 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine.
What is the SMILES notation for 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine?
The canonical SMILES for 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine is NC1=NC=CC2=CC2C1.
What is the InChIKey of 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine?
The InChIKey is QSRUUJLEGBCTAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c8-7-4-6-3-5(6)1-2-9-7/h1-3,6H,4H2,(H2,8,9).
What are the key properties of 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine?
4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine has a molecular weight of 120.15 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azabicyclo[5.1.0]octa-3,5,7-trien-3-amine is sourced from PubChem (CID 123392787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).