C8H16NO5P — CID 123392986
N-[1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]butan-2-yl]acetamide (PubChem CID 123392986) has the molecular formula C8H16NO5P and a molecular weight of 237.19 g/mol. Its IUPAC name is N-[1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]butan-2-yl]acetamide.
| Compound Name | N-[1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 123392986 |
| Molecular Formula | C8H16NO5P |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-[1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]butan-2-yl]acetamide |
| SMILES | CCC(COP1(=O)OCCO1)NC(C)=O |
| InChI | InChI=1S/C8H16NO5P/c1-3-8(9-7(2)10)6-14-15(11)12-4-5-13-15/h8H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | MXDTULBIEJJIGE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|