About 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine
6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 1233931) has the molecular formula C13H8N4S
and a molecular weight of 252.30 g/mol. Its IUPAC name is 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine.
Molecular Properties
| Compound Name | 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine |
| PubChem CID | 1233931 |
| Molecular Formula | C13H8N4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | c1csc(-c2nn3cnnc3c3ccccc23)c1 |
| InChI | InChI=1S/C13H8N4S/c1-2-5-10-9(4-1)12(11-6-3-7-18-11)16-17-8-14-15-13(10)17/h1-8H |
| InChIKey | YPDOEWYFORUOCO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine?
The IUPAC name of 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine (CID 1233931) is 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine.
What is the SMILES notation for 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine?
The canonical SMILES for 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine is c1csc(-c2nn3cnnc3c3ccccc23)c1.
What is the InChIKey of 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine?
The InChIKey is YPDOEWYFORUOCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4S/c1-2-5-10-9(4-1)12(11-6-3-7-18-11)16-17-8-14-15-13(10)17/h1-8H.
What are the key properties of 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine?
6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine has a molecular weight of 252.30 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-2-yl-[1,2,4]triazolo[3,4-a]phthalazine is sourced from PubChem (CID 1233931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).