About [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate
[4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate (PubChem CID 123393966) has the molecular formula C18H18FNO4S
and a molecular weight of 363.41 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate.
Molecular Properties
| Compound Name | [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate |
| PubChem CID | 123393966 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate |
| SMILES | CC1(C)C=C(c2ccc(F)cc2)c2ccc(COS(N)(=O)=O)cc2O1 |
| InChI | InChI=1S/C18H18FNO4S/c1-18(2)10-16(13-4-6-14(19)7-5-13)15-8-3-12(9-17(15)24-18)11-23-25(20,21)22/h3-10H,11H2,1-2H3,(H2,20,21,22) |
| InChIKey | CNLCKEBFWBSSSR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate?
The IUPAC name of [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate (CID 123393966) is [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate.
What is the SMILES notation for [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate?
The canonical SMILES for [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate is CC1(C)C=C(c2ccc(F)cc2)c2ccc(COS(N)(=O)=O)cc2O1.
What is the InChIKey of [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate?
The InChIKey is CNLCKEBFWBSSSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FNO4S/c1-18(2)10-16(13-4-6-14(19)7-5-13)15-8-3-12(9-17(15)24-18)11-23-25(20,21)22/h3-10H,11H2,1-2H3,(H2,20,21,22).
What are the key properties of [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate?
[4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate has a molecular weight of 363.41 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-fluorophenyl)-2,2-dimethylchromen-7-yl]methyl sulfamate is sourced from PubChem (CID 123393966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).