C18H15N3 — CID 123394077
2-cyclohepta-1,3,4,6-tetraen-1-yl-4-cyclohepta-1,3,6-trien-1-yl-6-methyl-1,3,5-triazine (PubChem CID 123394077) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-cyclohepta-1,3,4,6-tetraen-1-yl-4-cyclohepta-1,3,6-trien-1-yl-6-methyl-1,3,5-triazine.
| Compound Name | 2-cyclohepta-1,3,4,6-tetraen-1-yl-4-cyclohepta-1,3,6-trien-1-yl-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 123394077 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-cyclohepta-1,3,4,6-tetraen-1-yl-4-cyclohepta-1,3,6-trien-1-yl-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(C2=CC=C=CC=C2)nc(C2=CC=CCC=C2)n1 |
| InChI | InChI=1S/C18H15N3/c1-14-19-17(15-10-6-2-3-7-11-15)21-18(20-14)16-12-8-4-5-9-13-16/h2,4,6-13H,3H2,1H3 |
| InChIKey | RAQFBSRZTHQAEH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |