C17H22ClF4N4O2S+ — CID 123394196
2-[ethyl-[3-(3,3,3-trifluoropropylsulfanyl)propanoyl]amino]-3-[(5-fluoro-1-hydroxypyridin-1-ium-3-yl)-methylamino]prop-2-enimidoyl chloride (PubChem CID 123394196) has the molecular formula C17H22ClF4N4O2S+ and a molecular weight of 457.90 g/mol. Its IUPAC name is 2-[ethyl-[3-(3,3,3-trifluoropropylsulfanyl)propanoyl]amino]-3-[(5-fluoro-1-hydroxypyridin-1-ium-3-yl)-methylamino]prop-2-enimidoyl chloride.
| Compound Name | 2-[ethyl-[3-(3,3,3-trifluoropropylsulfanyl)propanoyl]amino]-3-[(5-fluoro-1-hydroxypyridin-1-ium-3-yl)-methylamino]prop-2-enimidoyl chloride |
|---|---|
| PubChem CID | 123394196 |
| Molecular Formula | C17H22ClF4N4O2S+ |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-[ethyl-[3-(3,3,3-trifluoropropylsulfanyl)propanoyl]amino]-3-[(5-fluoro-1-hydroxypyridin-1-ium-3-yl)-methylamino]prop-2-enimidoyl chloride |
| SMILES | [H]/N=C(\Cl)C(=CN(C)c1cc(F)c[n+](O)c1)N(CC)C(=O)CCSCCC(F)(F)F |
| InChI | InChI=1S/C17H22ClF4N4O2S/c1-3-26(15(27)4-6-29-7-5-17(20,21)22)14(16(18)23)11-24(2)13-8-12(19)9-25(28)10-13/h8-11,23,28H,3-7H2,1-2H3/q+1/b14-11?,23-16- |
| InChIKey | PYWRDQVDXWIPKT-BQPXGCQOSA-N |
| XLogP | 3.77 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|