C15H25N4+ — CID 123394612
[4-[(5,6-dimethylpyrimidin-4-yl)amino]cyclohexyl]methylidene-dimethylazanium (PubChem CID 123394612) has the molecular formula C15H25N4+ and a molecular weight of 261.39 g/mol. Its IUPAC name is [4-[(5,6-dimethylpyrimidin-4-yl)amino]cyclohexyl]methylidene-dimethylazanium.
| Compound Name | [4-[(5,6-dimethylpyrimidin-4-yl)amino]cyclohexyl]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 123394612 |
| Molecular Formula | C15H25N4+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | [4-[(5,6-dimethylpyrimidin-4-yl)amino]cyclohexyl]methylidene-dimethylazanium |
| SMILES | Cc1ncnc(NC2CCC(C=[N+](C)C)CC2)c1C |
| InChI | InChI=1S/C15H25N4/c1-11-12(2)16-10-17-15(11)18-14-7-5-13(6-8-14)9-19(3)4/h9-10,13-14H,5-8H2,1-4H3,(H,16,17,18)/q+1 |
| InChIKey | ZXQZUCTVRJOZAF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|