C26H40O4 — CID 123394655
(1-ethoxy-1-oxopropan-2-yl) 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)deca-2,4,6-trienoate (PubChem CID 123394655) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is (1-ethoxy-1-oxopropan-2-yl) 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)deca-2,4,6-trienoate.
| Compound Name | (1-ethoxy-1-oxopropan-2-yl) 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)deca-2,4,6-trienoate |
|---|---|
| PubChem CID | 123394655 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (1-ethoxy-1-oxopropan-2-yl) 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)deca-2,4,6-trienoate |
| SMILES | CCOC(=O)C(C)OC(=O)C=C(C)C=CC=C(C)CC(C)C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C26H40O4/c1-9-29-25(28)22(6)30-23(27)17-19(3)13-10-12-18(2)16-21(5)24-20(4)14-11-15-26(24,7)8/h10,12-13,17,21-22H,9,11,14-16H2,1-8H3 |
| InChIKey | MQVKIDLHPLNRPH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|