C17H19FN2O3S — CID 123395077
3-fluoro-N-(3-methoxypropyl)-5,5-dioxo-6,11-dihydrobenzo[c][2,1]benzothiazepin-11-amine (PubChem CID 123395077) has the molecular formula C17H19FN2O3S and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-fluoro-N-(3-methoxypropyl)-5,5-dioxo-6,11-dihydrobenzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | 3-fluoro-N-(3-methoxypropyl)-5,5-dioxo-6,11-dihydrobenzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 123395077 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 3-fluoro-N-(3-methoxypropyl)-5,5-dioxo-6,11-dihydrobenzo[c][2,1]benzothiazepin-11-amine |
| SMILES | COCCCNC1c2ccccc2NS(=O)(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C17H19FN2O3S/c1-23-10-4-9-19-17-13-5-2-3-6-15(13)20-24(21,22)16-11-12(18)7-8-14(16)17/h2-3,5-8,11,17,19-20H,4,9-10H2,1H3 |
| InChIKey | PHWUNFASRGLNEK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|