About 7-fluoro-4-methoxy-1,4-dihydroisoquinoline
7-fluoro-4-methoxy-1,4-dihydroisoquinoline (PubChem CID 123395742) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 7-fluoro-4-methoxy-1,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 7-fluoro-4-methoxy-1,4-dihydroisoquinoline |
| PubChem CID | 123395742 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 7-fluoro-4-methoxy-1,4-dihydroisoquinoline |
| SMILES | COC1C=NCc2cc(F)ccc21 |
| InChI | InChI=1S/C10H10FNO/c1-13-10-6-12-5-7-4-8(11)2-3-9(7)10/h2-4,6,10H,5H2,1H3 |
| InChIKey | SCSLOGWPZYFFOK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-4-methoxy-1,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-methoxy-1,4-dihydroisoquinoline?
The IUPAC name of 7-fluoro-4-methoxy-1,4-dihydroisoquinoline (CID 123395742) is 7-fluoro-4-methoxy-1,4-dihydroisoquinoline.
What is the SMILES notation for 7-fluoro-4-methoxy-1,4-dihydroisoquinoline?
The canonical SMILES for 7-fluoro-4-methoxy-1,4-dihydroisoquinoline is COC1C=NCc2cc(F)ccc21.
What is the InChIKey of 7-fluoro-4-methoxy-1,4-dihydroisoquinoline?
The InChIKey is SCSLOGWPZYFFOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO/c1-13-10-6-12-5-7-4-8(11)2-3-9(7)10/h2-4,6,10H,5H2,1H3.
What are the key properties of 7-fluoro-4-methoxy-1,4-dihydroisoquinoline?
7-fluoro-4-methoxy-1,4-dihydroisoquinoline has a molecular weight of 179.19 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-methoxy-1,4-dihydroisoquinoline is sourced from PubChem (CID 123395742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).