About 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene
1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene (PubChem CID 123396097) has the molecular formula C13H14
and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene.
Molecular Properties
| Compound Name | 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene |
| PubChem CID | 123396097 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene |
| SMILES | Cc1ccccc1CC1=CC=CC1 |
| InChI | InChI=1S/C13H14/c1-11-6-2-5-9-13(11)10-12-7-3-4-8-12/h2-7,9H,8,10H2,1H3 |
| InChIKey | YOIMDTJFRKYPLN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene?
The IUPAC name of 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene (CID 123396097) is 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene.
What is the SMILES notation for 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene?
The canonical SMILES for 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene is Cc1ccccc1CC1=CC=CC1.
What is the InChIKey of 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene?
The InChIKey is YOIMDTJFRKYPLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-11-6-2-5-9-13(11)10-12-7-3-4-8-12/h2-7,9H,8,10H2,1H3.
What are the key properties of 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene?
1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene has a molecular weight of 170.25 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopenta-1,3-dien-1-ylmethyl)-2-methylbenzene is sourced from PubChem (CID 123396097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).