About 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene
1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene (PubChem CID 123396471) has the molecular formula C14H16F4O
and a molecular weight of 276.27 g/mol. Its IUPAC name is 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene |
| PubChem CID | 123396471 |
| Molecular Formula | C14H16F4O |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene |
| SMILES | CC=C(F)C(=CC)C1=CC=C(OC(F)(F)F)C(C)C1 |
| InChI | InChI=1S/C14H16F4O/c1-4-11(12(15)5-2)10-6-7-13(9(3)8-10)19-14(16,17)18/h4-7,9H,8H2,1-3H3 |
| InChIKey | JVJDLOGVCNAFBV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene?
The IUPAC name of 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene (CID 123396471) is 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene.
What is the SMILES notation for 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene?
The canonical SMILES for 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene is CC=C(F)C(=CC)C1=CC=C(OC(F)(F)F)C(C)C1.
What is the InChIKey of 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene?
The InChIKey is JVJDLOGVCNAFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F4O/c1-4-11(12(15)5-2)10-6-7-13(9(3)8-10)19-14(16,17)18/h4-7,9H,8H2,1-3H3.
What are the key properties of 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene?
1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene has a molecular weight of 276.27 g/mol, XLogP of 5.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorohexa-2,4-dien-3-yl)-5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-diene is sourced from PubChem (CID 123396471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).