C28H27FN4O — CID 123396694
4-[6-[ethenyl(quinolin-6-ylmethyl)amino]-5-methyl-2-pyridinyl]-2-fluoro-N-propylbenzamide (PubChem CID 123396694) has the molecular formula C28H27FN4O and a molecular weight of 454.55 g/mol. Its IUPAC name is 4-[6-[ethenyl(quinolin-6-ylmethyl)amino]-5-methyl-2-pyridinyl]-2-fluoro-N-propylbenzamide.
| Compound Name | 4-[6-[ethenyl(quinolin-6-ylmethyl)amino]-5-methyl-2-pyridinyl]-2-fluoro-N-propylbenzamide |
|---|---|
| PubChem CID | 123396694 |
| Molecular Formula | C28H27FN4O |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-[6-[ethenyl(quinolin-6-ylmethyl)amino]-5-methyl-2-pyridinyl]-2-fluoro-N-propylbenzamide |
| SMILES | C=CN(Cc1ccc2ncccc2c1)c1nc(-c2ccc(C(=O)NCCC)c(F)c2)ccc1C |
| InChI | InChI=1S/C28H27FN4O/c1-4-14-31-28(34)23-11-10-22(17-24(23)29)26-12-8-19(3)27(32-26)33(5-2)18-20-9-13-25-21(16-20)7-6-15-30-25/h5-13,15-17H,2,4,14,18H2,1,3H3,(H,31,34) |
| InChIKey | JYTBDBOKVDGWOX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |