About 1-methoxypropylsilane
1-methoxypropylsilane (PubChem CID 123396975) has the molecular formula C4H12OSi
and a molecular weight of 104.23 g/mol. Its IUPAC name is 1-methoxypropylsilane.
Molecular Properties
| Compound Name | 1-methoxypropylsilane |
| PubChem CID | 123396975 |
| Molecular Formula | C4H12OSi |
| Molecular Weight | 104.23 g/mol |
| Exact Mass | 104.07 |
| IUPAC Name | 1-methoxypropylsilane |
| SMILES | CCC([SiH3])OC |
| InChI | InChI=1S/C4H12OSi/c1-3-4(6)5-2/h4H,3H2,1-2,6H3 |
| InChIKey | DFMMEIHQKNFRPW-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropylsilane?
The IUPAC name of 1-methoxypropylsilane (CID 123396975) is 1-methoxypropylsilane.
What is the SMILES notation for 1-methoxypropylsilane?
The canonical SMILES for 1-methoxypropylsilane is CCC([SiH3])OC.
What is the InChIKey of 1-methoxypropylsilane?
The InChIKey is DFMMEIHQKNFRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi/c1-3-4(6)5-2/h4H,3H2,1-2,6H3.
What are the key properties of 1-methoxypropylsilane?
1-methoxypropylsilane has a molecular weight of 104.23 g/mol, XLogP of -0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropylsilane is sourced from PubChem (CID 123396975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).