C20H21F2N3 — CID 123397028
N-(4,5-difluorocyclohepta-2,4,6-trien-1-yl)-5-methyl-1,2,3,4,9,10-hexahydrobenzo[b][1,6]naphthyridin-8-imine (PubChem CID 123397028) has the molecular formula C20H21F2N3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-(4,5-difluorocyclohepta-2,4,6-trien-1-yl)-5-methyl-1,2,3,4,9,10-hexahydrobenzo[b][1,6]naphthyridin-8-imine.
| Compound Name | N-(4,5-difluorocyclohepta-2,4,6-trien-1-yl)-5-methyl-1,2,3,4,9,10-hexahydrobenzo[b][1,6]naphthyridin-8-imine |
|---|---|
| PubChem CID | 123397028 |
| Molecular Formula | C20H21F2N3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-(4,5-difluorocyclohepta-2,4,6-trien-1-yl)-5-methyl-1,2,3,4,9,10-hexahydrobenzo[b][1,6]naphthyridin-8-imine |
| SMILES | CN1C2=C(CC3=C1CCNC3)C/C(=N/C1C=CC(F)=C(F)C=C1)C=C2 |
| InChI | InChI=1S/C20H21F2N3/c1-25-19-7-4-16(24-15-2-5-17(21)18(22)6-3-15)11-13(19)10-14-12-23-9-8-20(14)25/h2-7,15,23H,8-12H2,1H3/b24-16+ |
| InChIKey | IKLIFPNZRSSHGY-LFVJCYFKSA-N |
| XLogP | 3.87 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|