C12H13N3OS — CID 123397173
4-[5-(propylamino)-1,3,4-thiadiazol-2-yl]benzaldehyde (PubChem CID 123397173) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-[5-(propylamino)-1,3,4-thiadiazol-2-yl]benzaldehyde.
| Compound Name | 4-[5-(propylamino)-1,3,4-thiadiazol-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 123397173 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-[5-(propylamino)-1,3,4-thiadiazol-2-yl]benzaldehyde |
| SMILES | CCCNc1nnc(-c2ccc(C=O)cc2)s1 |
| InChI | InChI=1S/C12H13N3OS/c1-2-7-13-12-15-14-11(17-12)10-5-3-9(8-16)4-6-10/h3-6,8H,2,7H2,1H3,(H,13,15) |
| InChIKey | OIGBMOPNVCLMNH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|