About (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine
(3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine (PubChem CID 123397251) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine.
Molecular Properties
| Compound Name | (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine |
| PubChem CID | 123397251 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine |
| SMILES | C=N/C=C(C(=C)C)\C(C)=N\C |
| InChI | InChI=1S/C9H14N2/c1-7(2)9(6-10-4)8(3)11-5/h6H,1,4H2,2-3,5H3/b9-6-,11-8+ |
| InChIKey | XZWPGQKGNKKCQD-DJAXYUIYSA-N |
| XLogP | 2.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine?
The IUPAC name of (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine (CID 123397251) is (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine.
What is the SMILES notation for (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine?
The canonical SMILES for (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine is C=N/C=C(C(=C)C)\C(C)=N\C.
What is the InChIKey of (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine?
The InChIKey is XZWPGQKGNKKCQD-DJAXYUIYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7(2)9(6-10-4)8(3)11-5/h6H,1,4H2,2-3,5H3/b9-6-,11-8+.
What are the key properties of (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine?
(3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine has a molecular weight of 150.22 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N,4-dimethyl-3-[(methylideneamino)methylidene]pent-4-en-2-imine is sourced from PubChem (CID 123397251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).