C16H34 — CID 123397627
5-ethyl-2,8-dimethyl-5-propan-2-ylnonane (PubChem CID 123397627) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is 5-ethyl-2,8-dimethyl-5-propan-2-ylnonane.
| Compound Name | 5-ethyl-2,8-dimethyl-5-propan-2-ylnonane |
|---|---|
| PubChem CID | 123397627 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 5-ethyl-2,8-dimethyl-5-propan-2-ylnonane |
| SMILES | CCC(CCC(C)C)(CCC(C)C)C(C)C |
| InChI | InChI=1S/C16H34/c1-8-16(15(6)7,11-9-13(2)3)12-10-14(4)5/h13-15H,8-12H2,1-7H3 |
| InChIKey | RLWBEAFHWAIQLA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |