About [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane
[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane (PubChem CID 123397900) has the molecular formula C12H10ClN3OS
and a molecular weight of 279.75 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane |
| PubChem CID | 123397900 |
| Molecular Formula | C12H10ClN3OS |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane |
| SMILES | C#CC=S(C)(=O)c1nc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C12H10ClN3OS/c1-3-8-18(2,17)12-14-11(15-16-12)9-4-6-10(13)7-5-9/h1,4-8H,2H3,(H,14,15,16) |
| InChIKey | IJRYBQPJORAWBR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane?
The IUPAC name of [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane (CID 123397900) is [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane.
What is the SMILES notation for [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane?
The canonical SMILES for [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane is C#CC=S(C)(=O)c1nc(-c2ccc(Cl)cc2)n[nH]1.
What is the InChIKey of [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane?
The InChIKey is IJRYBQPJORAWBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3OS/c1-3-8-18(2,17)12-14-11(15-16-12)9-4-6-10(13)7-5-9/h1,4-8H,2H3,(H,14,15,16).
What are the key properties of [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane?
[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane has a molecular weight of 279.75 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]-methyl-oxo-prop-2-ynylidene-λ6-sulfane is sourced from PubChem (CID 123397900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).