C25H49N2O4SSi+ — CID 123398119
(4-butan-2-ylphenyl)methyl-trimethylazanium;N-[1-(3-trimethoxysilylpropylsulfanyl)propan-2-yl]acetamide (PubChem CID 123398119) has the molecular formula C25H49N2O4SSi+ and a molecular weight of 501.83 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)methyl-trimethylazanium;N-[1-(3-trimethoxysilylpropylsulfanyl)propan-2-yl]acetamide.
| Compound Name | (4-butan-2-ylphenyl)methyl-trimethylazanium;N-[1-(3-trimethoxysilylpropylsulfanyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 123398119 |
| Molecular Formula | C25H49N2O4SSi+ |
| Molecular Weight | 501.83 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | (4-butan-2-ylphenyl)methyl-trimethylazanium;N-[1-(3-trimethoxysilylpropylsulfanyl)propan-2-yl]acetamide |
| SMILES | CCC(C)c1ccc(C[N+](C)(C)C)cc1.CO[Si](CCCSCC(C)NC(C)=O)(OC)OC |
| InChI | InChI=1S/C14H24N.C11H25NO4SSi/c1-6-12(2)14-9-7-13(8-10-14)11-15(3,4)5;1-10(12-11(2)13)9-17-7-6-8-18(14-3,15-4)16-5/h7-10,12H,6,11H2,1-5H3;10H,6-9H2,1-5H3,(H,12,13)/q+1; |
| InChIKey | POEMDFSQKFQASJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.83 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|