About methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate
methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate (PubChem CID 123398190) has the molecular formula C14H19BrFNO2
and a molecular weight of 332.21 g/mol. Its IUPAC name is methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate.
Molecular Properties
| Compound Name | methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate |
| PubChem CID | 123398190 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate |
| SMILES | C=C(F)C=CC(=C)C(C)C(C(=O)OC)/C(CBr)=N/C |
| InChI | InChI=1S/C14H19BrFNO2/c1-9(6-7-10(2)16)11(3)13(14(18)19-5)12(8-15)17-4/h6-7,11,13H,1-2,8H2,3-5H3/b7-6?,17-12+ |
| InChIKey | OSSHIDCEXKZDCJ-QEQWOOGVSA-N |
| XLogP | 3.47 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate?
The IUPAC name of methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate (CID 123398190) is methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate.
What is the SMILES notation for methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate?
The canonical SMILES for methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate is C=C(F)C=CC(=C)C(C)C(C(=O)OC)/C(CBr)=N/C.
What is the InChIKey of methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate?
The InChIKey is OSSHIDCEXKZDCJ-QEQWOOGVSA-N. The full InChI is InChI=1S/C14H19BrFNO2/c1-9(6-7-10(2)16)11(3)13(14(18)19-5)12(8-15)17-4/h6-7,11,13H,1-2,8H2,3-5H3/b7-6?,17-12+.
What are the key properties of methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate?
methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate has a molecular weight of 332.21 g/mol, XLogP of 3.47, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[C-(bromomethyl)-N-methylcarbonimidoyl]-7-fluoro-3-methyl-4-methylideneocta-5,7-dienoate is sourced from PubChem (CID 123398190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).