C18H10ClN4O2+ — CID 123398295
[4-(3-chloropyrazin-2-yl)oxyphenyl]-(1,5-dihydrobenzimidazol-5-ylium-2-yl)methanone (PubChem CID 123398295) has the molecular formula C18H10ClN4O2+ and a molecular weight of 349.76 g/mol. Its IUPAC name is [4-(3-chloropyrazin-2-yl)oxyphenyl]-(1,5-dihydrobenzimidazol-5-ylium-2-yl)methanone.
| Compound Name | [4-(3-chloropyrazin-2-yl)oxyphenyl]-(1,5-dihydrobenzimidazol-5-ylium-2-yl)methanone |
|---|---|
| PubChem CID | 123398295 |
| Molecular Formula | C18H10ClN4O2+ |
| Molecular Weight | 349.76 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [4-(3-chloropyrazin-2-yl)oxyphenyl]-(1,5-dihydrobenzimidazol-5-ylium-2-yl)methanone |
| SMILES | O=C(c1ccc(Oc2nccnc2Cl)cc1)c1nc2c([nH]1)C=C[C+]=C2 |
| InChI | InChI=1S/C18H9ClN4O2/c19-16-18(21-10-9-20-16)25-12-7-5-11(6-8-12)15(24)17-22-13-3-1-2-4-14(13)23-17/h1,3-10H/p+1 |
| InChIKey | DPNNHDPUZPNURB-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|