C25H30N6O5 — CID 123398310
N-[(3-amino-4-hydroxyphenyl)methyl]-2-methyl-6-[5-[4-(2-oxopropanoylamino)cyclohexyl]-4,5-dihydro-1,2-oxazol-3-yl]pyrimidine-4-carboxamide (PubChem CID 123398310) has the molecular formula C25H30N6O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[(3-amino-4-hydroxyphenyl)methyl]-2-methyl-6-[5-[4-(2-oxopropanoylamino)cyclohexyl]-4,5-dihydro-1,2-oxazol-3-yl]pyrimidine-4-carboxamide.
| Compound Name | N-[(3-amino-4-hydroxyphenyl)methyl]-2-methyl-6-[5-[4-(2-oxopropanoylamino)cyclohexyl]-4,5-dihydro-1,2-oxazol-3-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 123398310 |
| Molecular Formula | C25H30N6O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | N-[(3-amino-4-hydroxyphenyl)methyl]-2-methyl-6-[5-[4-(2-oxopropanoylamino)cyclohexyl]-4,5-dihydro-1,2-oxazol-3-yl]pyrimidine-4-carboxamide |
| SMILES | CC(=O)C(=O)NC1CCC(C2CC(c3cc(C(=O)NCc4ccc(O)c(N)c4)nc(C)n3)=NO2)CC1 |
| InChI | InChI=1S/C25H30N6O5/c1-13(32)24(34)30-17-6-4-16(5-7-17)23-11-20(31-36-23)19-10-21(29-14(2)28-19)25(35)27-12-15-3-8-22(33)18(26)9-15/h3,8-10,16-17,23,33H,4-7,11-12,26H2,1-2H3,(H,27,35)(H,30,34) |
| InChIKey | MHEFSXKPMVEBNO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 168.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|