C20H32FN3 — CID 123398382
5-[2-(6-fluorocyclohexa-1,3-dien-1-yl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl]-4-methylhexan-2-imine (PubChem CID 123398382) has the molecular formula C20H32FN3 and a molecular weight of 333.50 g/mol. Its IUPAC name is 5-[2-(6-fluorocyclohexa-1,3-dien-1-yl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl]-4-methylhexan-2-imine.
| Compound Name | 5-[2-(6-fluorocyclohexa-1,3-dien-1-yl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl]-4-methylhexan-2-imine |
|---|---|
| PubChem CID | 123398382 |
| Molecular Formula | C20H32FN3 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 5-[2-(6-fluorocyclohexa-1,3-dien-1-yl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl]-4-methylhexan-2-imine |
| SMILES | [H]/N=C(\C)CC(C)C(C)N1CCC2NC(C3=CC=CCC3F)CC2C1 |
| InChI | InChI=1S/C20H32FN3/c1-13(10-14(2)22)15(3)24-9-8-19-16(12-24)11-20(23-19)17-6-4-5-7-18(17)21/h4-6,13,15-16,18-20,22-23H,7-12H2,1-3H3/b22-14+ |
| InChIKey | HQTKQRZDANGRJX-HYARGMPZSA-N |
| XLogP | 3.72 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|