C36H46F7NO4S — CID 123398499
3-fluoro-6-(4-fluoro-3-hydroxyphenyl)-5-[6-[2-[4-(4,4,5,5,5-pentafluoropentylsulfonyl)butyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 123398499) has the molecular formula C36H46F7NO4S and a molecular weight of 721.82 g/mol. Its IUPAC name is 3-fluoro-6-(4-fluoro-3-hydroxyphenyl)-5-[6-[2-[4-(4,4,5,5,5-pentafluoropentylsulfonyl)butyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 3-fluoro-6-(4-fluoro-3-hydroxyphenyl)-5-[6-[2-[4-(4,4,5,5,5-pentafluoropentylsulfonyl)butyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 123398499 |
| Molecular Formula | C36H46F7NO4S |
| Molecular Weight | 721.82 g/mol |
| Exact Mass | 721.30 |
| IUPAC Name | 3-fluoro-6-(4-fluoro-3-hydroxyphenyl)-5-[6-[2-[4-(4,4,5,5,5-pentafluoropentylsulfonyl)butyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | O=S(=O)(CCCCC1CCCN1CCCCCCC1=C(c2ccc(F)c(O)c2)CCCc2cc(O)c(F)cc21)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C36H46F7NO4S/c37-31-16-15-26(23-33(31)45)28-14-7-10-25-22-34(46)32(38)24-30(25)29(28)13-3-1-2-5-18-44-19-8-12-27(44)11-4-6-20-49(47,48)21-9-17-35(39,40)36(41,42)43/h15-16,22-24,27,45-46H,1-14,17-21H2 |
| InChIKey | WWADMMBQQLAHBJ-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.82 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|