About 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid
5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid (PubChem CID 123398675) has the molecular formula C11H10BrNO3
and a molecular weight of 284.11 g/mol. Its IUPAC name is 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 123398675 |
| Molecular Formula | C11H10BrNO3 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid |
| SMILES | Cc1noc(C2=CC=C(Br)CC2)c1C(=O)O |
| InChI | InChI=1S/C11H10BrNO3/c1-6-9(11(14)15)10(16-13-6)7-2-4-8(12)5-3-7/h2,4H,3,5H2,1H3,(H,14,15) |
| InChIKey | WLOQPKBZEPBHLO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid (CID 123398675) is 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid is Cc1noc(C2=CC=C(Br)CC2)c1C(=O)O.
What is the InChIKey of 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid?
The InChIKey is WLOQPKBZEPBHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO3/c1-6-9(11(14)15)10(16-13-6)7-2-4-8(12)5-3-7/h2,4H,3,5H2,1H3,(H,14,15).
What are the key properties of 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid?
5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid has a molecular weight of 284.11 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromocyclohexa-1,3-dien-1-yl)-3-methyl-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 123398675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).