C17H19NO3 — CID 123398730
N-[2-(2,5-dihydroxyphenyl)-2-methylpropyl]benzamide (PubChem CID 123398730) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[2-(2,5-dihydroxyphenyl)-2-methylpropyl]benzamide.
| Compound Name | N-[2-(2,5-dihydroxyphenyl)-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 123398730 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-[2-(2,5-dihydroxyphenyl)-2-methylpropyl]benzamide |
| SMILES | CC(C)(CNC(=O)c1ccccc1)c1cc(O)ccc1O |
| InChI | InChI=1S/C17H19NO3/c1-17(2,14-10-13(19)8-9-15(14)20)11-18-16(21)12-6-4-3-5-7-12/h3-10,19-20H,11H2,1-2H3,(H,18,21) |
| InChIKey | WDWLVAGPTGFVQF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|