C21H24O — CID 123398958
3-but-2-enyl-6-(3-ethenylhepta-1,5-dien-3-yloxy)cycloocta-1,2,4-trien-7-yne (PubChem CID 123398958) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-but-2-enyl-6-(3-ethenylhepta-1,5-dien-3-yloxy)cycloocta-1,2,4-trien-7-yne.
| Compound Name | 3-but-2-enyl-6-(3-ethenylhepta-1,5-dien-3-yloxy)cycloocta-1,2,4-trien-7-yne |
|---|---|
| PubChem CID | 123398958 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-but-2-enyl-6-(3-ethenylhepta-1,5-dien-3-yloxy)cycloocta-1,2,4-trien-7-yne |
| SMILES | C=CC(C=C)(CC=CC)OC1C#CC=C=C(CC=CC)C=C1 |
| InChI | InChI=1S/C21H24O/c1-5-9-13-19-14-11-12-15-20(17-16-19)22-21(7-3,8-4)18-10-6-2/h5-11,16-17,20H,3-4,13,18H2,1-2H3 |
| InChIKey | UORZSNPGTKOYRP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|