C28H30Si — CID 123399072
1,2,3,4-tetra(cyclohexa-2,4-dien-1-yl)-1H-silole (PubChem CID 123399072) has the molecular formula C28H30Si and a molecular weight of 394.63 g/mol. Its IUPAC name is 1,2,3,4-tetra(cyclohexa-2,4-dien-1-yl)-1H-silole.
| Compound Name | 1,2,3,4-tetra(cyclohexa-2,4-dien-1-yl)-1H-silole |
|---|---|
| PubChem CID | 123399072 |
| Molecular Formula | C28H30Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 1,2,3,4-tetra(cyclohexa-2,4-dien-1-yl)-1H-silole |
| SMILES | C1=CCC(C2=C[SiH](C3C=CC=CC3)C(C3C=CC=CC3)=C2C2C=CC=CC2)C=C1 |
| InChI | InChI=1S/C28H30Si/c1-5-13-22(14-6-1)26-21-29(25-19-11-4-12-20-25)28(24-17-9-3-10-18-24)27(26)23-15-7-2-8-16-23/h1-13,15,17,19,21-25,29H,14,16,18,20H2 |
| InChIKey | SVPHEAPOJBAFQB-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|