C10H15N3O8 — CID 123399343
2-[2-[carbamimidoyl(methyl)amino]acetyl]oxypropane-1,2,3-tricarboxylic acid (PubChem CID 123399343) has the molecular formula C10H15N3O8 and a molecular weight of 305.24 g/mol. Its IUPAC name is 2-[2-[carbamimidoyl(methyl)amino]acetyl]oxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-[2-[carbamimidoyl(methyl)amino]acetyl]oxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 123399343 |
| Molecular Formula | C10H15N3O8 |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[2-[carbamimidoyl(methyl)amino]acetyl]oxypropane-1,2,3-tricarboxylic acid |
| SMILES | [H]/N=C(\N)N(C)CC(=O)OC(CC(=O)O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H15N3O8/c1-13(9(11)12)4-7(18)21-10(8(19)20,2-5(14)15)3-6(16)17/h2-4H2,1H3,(H3,11,12)(H,14,15)(H,16,17)(H,19,20) |
| InChIKey | YXXZBTVGCIZGGK-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 191.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|