About dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate
dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate (PubChem CID 123399443) has the molecular formula C9H11F3O5
and a molecular weight of 256.18 g/mol. Its IUPAC name is dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate.
Molecular Properties
| Compound Name | dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate |
| PubChem CID | 123399443 |
| Molecular Formula | C9H11F3O5 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate |
| SMILES | COC(=O)C=C(OC(C)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H11F3O5/c1-5(9(10,11)12)17-6(8(14)16-3)4-7(13)15-2/h4-5H,1-3H3 |
| InChIKey | RVPXRERXYXXGTD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate?
The IUPAC name of dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate (CID 123399443) is dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate.
What is the SMILES notation for dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate?
The canonical SMILES for dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate is COC(=O)C=C(OC(C)C(F)(F)F)C(=O)OC.
What is the InChIKey of dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate?
The InChIKey is RVPXRERXYXXGTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O5/c1-5(9(10,11)12)17-6(8(14)16-3)4-7(13)15-2/h4-5H,1-3H3.
What are the key properties of dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate?
dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate has a molecular weight of 256.18 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(1,1,1-trifluoropropan-2-yloxy)but-2-enedioate is sourced from PubChem (CID 123399443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).