About diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate
diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 123399551) has the molecular formula C12H18FNO4
and a molecular weight of 259.28 g/mol. Its IUPAC name is diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate.
Analyze diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate?
The IUPAC name of diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate (CID 123399551) is diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate.
What is the SMILES notation for diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate?
The canonical SMILES for diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate is CCOC(=O)C1CC(F)C2C(C(=O)OCC)C12N.
What is the InChIKey of diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate?
The InChIKey is BMMFGFMQLLWDSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FNO4/c1-3-17-10(15)6-5-7(13)8-9(12(6,8)14)11(16)18-4-2/h6-9H,3-5,14H2,1-2H3.
What are the key properties of diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate?
diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate has a molecular weight of 259.28 g/mol, XLogP of 0.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylate is sourced from PubChem (CID 123399551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).